ChemNet > CAS > 287172-74-1 2-Chloro-3,6-difluorobenzoic acid
287172-74-1 2-Chloro-3,6-difluorobenzoic acid
| نام محصول |
2-Chloro-3,6-difluorobenzoic acid |
| میدان مغناطیسی |
C7H3ClF2O2 |
| وزن مولکولی |
192.5473 |
| InChI |
InChI=1/C7H3ClF2O2/c8-6-4(10)2-1-3(9)5(6)7(11)12/h1-2H,(H,11,12) |
| شماره سیایاس |
287172-74-1 |
| ساختار مولکولی |
|
| تراکم |
1.573g/cm3 |
| نقطه غلیان |
266.6°C at 760 mmHg |
| ضریب شکست |
1.534 |
| نقطه اشتعال |
115°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
